C22H32N2O8 — CID 10874088
dimethyl 2,3-bis[2-(tert-butylamino)-2-oxoethoxy]benzene-1,4-dicarboxylate (PubChem CID 10874088) has the molecular formula C22H32N2O8 and a molecular weight of 452.50 g/mol. Its IUPAC name is dimethyl 2,3-bis[2-(tert-butylamino)-2-oxoethoxy]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2,3-bis[2-(tert-butylamino)-2-oxoethoxy]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 10874088 |
| Molecular Formula | C22H32N2O8 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | dimethyl 2,3-bis[2-(tert-butylamino)-2-oxoethoxy]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(OCC(=O)NC(C)(C)C)c1OCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C22H32N2O8/c1-21(2,3)23-15(25)11-31-17-13(19(27)29-7)9-10-14(20(28)30-8)18(17)32-12-16(26)24-22(4,5)6/h9-10H,11-12H2,1-8H3,(H,23,25)(H,24,26) |
| InChIKey | GQBWEVRDYJTMHI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |