C14H18N2O3 — CID 54880636
4-methyl-N-[2-(3-oxobutanoylamino)ethyl]benzamide (PubChem CID 54880636) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 4-methyl-N-[2-(3-oxobutanoylamino)ethyl]benzamide.
| Compound Name | 4-methyl-N-[2-(3-oxobutanoylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 54880636 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 4-methyl-N-[2-(3-oxobutanoylamino)ethyl]benzamide |
| SMILES | CC(=O)CC(=O)NCCNC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H18N2O3/c1-10-3-5-12(6-4-10)14(19)16-8-7-15-13(18)9-11(2)17/h3-6H,7-9H2,1-2H3,(H,15,18)(H,16,19) |
| InChIKey | WZEZKKVWFCJVJZ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|