C18H27N5O5S — CID 18774750
[(2S,3S)-3-methyl-1-oxo-1-[2-(3-pyrrolidin-1-ylsulfonylbenzoyl)hydrazinyl]pentan-2-yl]urea (PubChem CID 18774750) has the molecular formula C18H27N5O5S and a molecular weight of 425.51 g/mol. Its IUPAC name is [(2S,3S)-3-methyl-1-oxo-1-[2-(3-pyrrolidin-1-ylsulfonylbenzoyl)hydrazinyl]pentan-2-yl]urea.
| Compound Name | [(2S,3S)-3-methyl-1-oxo-1-[2-(3-pyrrolidin-1-ylsulfonylbenzoyl)hydrazinyl]pentan-2-yl]urea |
|---|---|
| PubChem CID | 18774750 |
| Molecular Formula | C18H27N5O5S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | [(2S,3S)-3-methyl-1-oxo-1-[2-(3-pyrrolidin-1-ylsulfonylbenzoyl)hydrazinyl]pentan-2-yl]urea |
| SMILES | CC[C@H](C)[C@H](NC(N)=O)C(=O)NNC(=O)c1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C18H27N5O5S/c1-3-12(2)15(20-18(19)26)17(25)22-21-16(24)13-7-6-8-14(11-13)29(27,28)23-9-4-5-10-23/h6-8,11-12,15H,3-5,9-10H2,1-2H3,(H,21,24)(H,22,25)(H3,19,20,26)/t12-,15-/m0/s1 |
| InChIKey | HZHSPAJAWPMRAO-WFASDCNBSA-N |
| XLogP | 0.32 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|