C19H30N4O4 — CID 24637501
[3-methyl-1-[2-[4-(3-methylbutoxy)benzoyl]hydrazinyl]-1-oxopentan-2-yl]urea (PubChem CID 24637501) has the molecular formula C19H30N4O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is [3-methyl-1-[2-[4-(3-methylbutoxy)benzoyl]hydrazinyl]-1-oxopentan-2-yl]urea.
| Compound Name | [3-methyl-1-[2-[4-(3-methylbutoxy)benzoyl]hydrazinyl]-1-oxopentan-2-yl]urea |
|---|---|
| PubChem CID | 24637501 |
| Molecular Formula | C19H30N4O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | [3-methyl-1-[2-[4-(3-methylbutoxy)benzoyl]hydrazinyl]-1-oxopentan-2-yl]urea |
| SMILES | CCC(C)C(NC(N)=O)C(=O)NNC(=O)c1ccc(OCCC(C)C)cc1 |
| InChI | InChI=1S/C19H30N4O4/c1-5-13(4)16(21-19(20)26)18(25)23-22-17(24)14-6-8-15(9-7-14)27-11-10-12(2)3/h6-9,12-13,16H,5,10-11H2,1-4H3,(H,22,24)(H,23,25)(H3,20,21,26) |
| InChIKey | HVGWHXUQOHTVRH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|