C14H19FN4O4 — CID 9379100
[(2S)-1-[2-[2-(4-fluorophenoxy)acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]urea (PubChem CID 9379100) has the molecular formula C14H19FN4O4 and a molecular weight of 326.33 g/mol. Its IUPAC name is [(2S)-1-[2-[2-(4-fluorophenoxy)acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]urea.
| Compound Name | [(2S)-1-[2-[2-(4-fluorophenoxy)acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]urea |
|---|---|
| PubChem CID | 9379100 |
| Molecular Formula | C14H19FN4O4 |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | [(2S)-1-[2-[2-(4-fluorophenoxy)acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]urea |
| SMILES | CC(C)[C@H](NC(N)=O)C(=O)NNC(=O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C14H19FN4O4/c1-8(2)12(17-14(16)22)13(21)19-18-11(20)7-23-10-5-3-9(15)4-6-10/h3-6,8,12H,7H2,1-2H3,(H,18,20)(H,19,21)(H3,16,17,22)/t12-/m0/s1 |
| InChIKey | XXVWGQKXJDRFNV-LBPRGKRZSA-N |
| XLogP | 0.04 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|