C16H24N4O4 — CID 4801112
[1-[2-[2-(4-ethylphenoxy)acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]urea (PubChem CID 4801112) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is [1-[2-[2-(4-ethylphenoxy)acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]urea.
| Compound Name | [1-[2-[2-(4-ethylphenoxy)acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]urea |
|---|---|
| PubChem CID | 4801112 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | [1-[2-[2-(4-ethylphenoxy)acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]urea |
| SMILES | CCc1ccc(OCC(=O)NNC(=O)C(NC(N)=O)C(C)C)cc1 |
| InChI | InChI=1S/C16H24N4O4/c1-4-11-5-7-12(8-6-11)24-9-13(21)19-20-15(22)14(10(2)3)18-16(17)23/h5-8,10,14H,4,9H2,1-3H3,(H,19,21)(H,20,22)(H3,17,18,23) |
| InChIKey | HNKUKCAIRHDCFO-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|