C25H27N3O3 — CID 98367764
3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[2-(2,3-dihydroindol-1-yl)phenyl]propanamide (PubChem CID 98367764) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[2-(2,3-dihydroindol-1-yl)phenyl]propanamide.
| Compound Name | 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[2-(2,3-dihydroindol-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 98367764 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[2-(2,3-dihydroindol-1-yl)phenyl]propanamide |
| SMILES | O=C(CCN1C(=O)[C@@H]2CCCC[C@H]2C1=O)Nc1ccccc1N1CCc2ccccc21 |
| InChI | InChI=1S/C25H27N3O3/c29-23(14-16-28-24(30)18-8-2-3-9-19(18)25(28)31)26-20-10-4-6-12-22(20)27-15-13-17-7-1-5-11-21(17)27/h1,4-7,10-12,18-19H,2-3,8-9,13-16H2,(H,26,29)/t18-,19-/m1/s1 |
| InChIKey | MBDUMAQXVHMGGV-RTBURBONSA-N |
| XLogP | 3.88 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|