C20H21N3O3 — CID 8763248
3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-isoquinolin-5-ylpropanamide (PubChem CID 8763248) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-isoquinolin-5-ylpropanamide.
| Compound Name | 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-isoquinolin-5-ylpropanamide |
|---|---|
| PubChem CID | 8763248 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-isoquinolin-5-ylpropanamide |
| SMILES | O=C(CCN1C(=O)[C@H]2CCCC[C@H]2C1=O)Nc1cccc2cnccc12 |
| InChI | InChI=1S/C20H21N3O3/c24-18(22-17-7-3-4-13-12-21-10-8-14(13)17)9-11-23-19(25)15-5-1-2-6-16(15)20(23)26/h3-4,7-8,10,12,15-16H,1-2,5-6,9,11H2,(H,22,24)/t15-,16+ |
| InChIKey | AIKMDLPTJQKWFF-IYBDPMFKSA-N |
| XLogP | 2.74 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|