C17H17F2NO4 — CID 6597612
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] (1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 6597612) has the molecular formula C17H17F2NO4 and a molecular weight of 337.32 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] (1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] (1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 6597612 |
| Molecular Formula | C17H17F2NO4 |
| Molecular Weight | 337.32 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] (1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(COC(=O)[C@H]1C[C@@H]2C=C[C@H]1C2)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C17H17F2NO4/c18-17(19)24-14-4-2-1-3-13(14)20-15(21)9-23-16(22)12-8-10-5-6-11(12)7-10/h1-6,10-12,17H,7-9H2,(H,20,21)/t10-,11+,12+/m1/s1 |
| InChIKey | JBAWAEXUNQUUHL-WOPDTQHZSA-N |
| XLogP | 2.98 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|