C17H18N2O4 — CID 6597722
[2-(4-carbamoylanilino)-2-oxoethyl] (1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 6597722) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is [2-(4-carbamoylanilino)-2-oxoethyl] (1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [2-(4-carbamoylanilino)-2-oxoethyl] (1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 6597722 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | [2-(4-carbamoylanilino)-2-oxoethyl] (1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | NC(=O)c1ccc(NC(=O)COC(=O)[C@H]2C[C@@H]3C=C[C@H]2C3)cc1 |
| InChI | InChI=1S/C17H18N2O4/c18-16(21)11-3-5-13(6-4-11)19-15(20)9-23-17(22)14-8-10-1-2-12(14)7-10/h1-6,10,12,14H,7-9H2,(H2,18,21)(H,19,20)/t10-,12+,14+/m1/s1 |
| InChIKey | FCWDKOPVQSXLJV-OSMZGAPFSA-N |
| XLogP | 1.48 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|