C16H14I3NO3 — CID 4023699
[2-oxo-2-(2,4,6-triiodoanilino)ethyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 4023699) has the molecular formula C16H14I3NO3 and a molecular weight of 649.00 g/mol. Its IUPAC name is [2-oxo-2-(2,4,6-triiodoanilino)ethyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [2-oxo-2-(2,4,6-triiodoanilino)ethyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 4023699 |
| Molecular Formula | C16H14I3NO3 |
| Molecular Weight | 649.00 g/mol |
| Exact Mass | 648.81 |
| IUPAC Name | [2-oxo-2-(2,4,6-triiodoanilino)ethyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(COC(=O)C1CC2C=CC1C2)Nc1c(I)cc(I)cc1I |
| InChI | InChI=1S/C16H14I3NO3/c17-10-5-12(18)15(13(19)6-10)20-14(21)7-23-16(22)11-4-8-1-2-9(11)3-8/h1-2,5-6,8-9,11H,3-4,7H2,(H,20,21) |
| InChIKey | DPDMHDCPTSIGML-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.00 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|