C17H15F2NO5 — CID 23307153
[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] (1R,2S,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 23307153) has the molecular formula C17H15F2NO5 and a molecular weight of 351.31 g/mol. Its IUPAC name is [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] (1R,2S,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] (1R,2S,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 23307153 |
| Molecular Formula | C17H15F2NO5 |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] (1R,2S,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(COC(=O)[C@H]1C[C@H]2C=C[C@H]1C2)Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C17H15F2NO5/c18-17(19)24-13-4-3-11(7-14(13)25-17)20-15(21)8-23-16(22)12-6-9-1-2-10(12)5-9/h1-4,7,9-10,12H,5-6,8H2,(H,20,21)/t9-,10-,12-/m0/s1 |
| InChIKey | YMTWNUQMSIPQAH-NHCYSSNCSA-N |
| XLogP | 2.70 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|