C16H15Cl2NO3 — CID 7458866
[2-(3,5-dichloroanilino)-2-oxoethyl] (1S,2R,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 7458866) has the molecular formula C16H15Cl2NO3 and a molecular weight of 340.21 g/mol. Its IUPAC name is [2-(3,5-dichloroanilino)-2-oxoethyl] (1S,2R,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [2-(3,5-dichloroanilino)-2-oxoethyl] (1S,2R,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 7458866 |
| Molecular Formula | C16H15Cl2NO3 |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | [2-(3,5-dichloroanilino)-2-oxoethyl] (1S,2R,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(COC(=O)[C@@H]1C[C@@H]2C=C[C@@H]1C2)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H15Cl2NO3/c17-11-5-12(18)7-13(6-11)19-15(20)8-22-16(21)14-4-9-1-2-10(14)3-9/h1-2,5-7,9-10,14H,3-4,8H2,(H,19,20)/t9-,10-,14-/m1/s1 |
| InChIKey | ATNXCJKEHGVYPT-GPCCPHFNSA-N |
| XLogP | 3.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|