C19H14F2N2O4 — CID 4010843
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] quinoline-2-carboxylate (PubChem CID 4010843) has the molecular formula C19H14F2N2O4 and a molecular weight of 372.33 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] quinoline-2-carboxylate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] quinoline-2-carboxylate |
|---|---|
| PubChem CID | 4010843 |
| Molecular Formula | C19H14F2N2O4 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] quinoline-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2ccccc2n1)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C19H14F2N2O4/c20-19(21)27-16-8-4-3-7-14(16)23-17(24)11-26-18(25)15-10-9-12-5-1-2-6-13(12)22-15/h1-10,19H,11H2,(H,23,24) |
| InChIKey | UVNBNCCHYYBSSZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |