C18H12F2N2O3 — CID 2466704
[2-(3,4-difluoroanilino)-2-oxoethyl] quinoline-2-carboxylate (PubChem CID 2466704) has the molecular formula C18H12F2N2O3 and a molecular weight of 342.30 g/mol. Its IUPAC name is [2-(3,4-difluoroanilino)-2-oxoethyl] quinoline-2-carboxylate.
| Compound Name | [2-(3,4-difluoroanilino)-2-oxoethyl] quinoline-2-carboxylate |
|---|---|
| PubChem CID | 2466704 |
| Molecular Formula | C18H12F2N2O3 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | [2-(3,4-difluoroanilino)-2-oxoethyl] quinoline-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2ccccc2n1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H12F2N2O3/c19-13-7-6-12(9-14(13)20)21-17(23)10-25-18(24)16-8-5-11-3-1-2-4-15(11)22-16/h1-9H,10H2,(H,21,23) |
| InChIKey | YSVVPFOSOJIRMJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |