C18H17F3N2O5 — CID 2448157
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] (2S)-2-(furan-2-carbonylamino)-3-methylbutanoate (PubChem CID 2448157) has the molecular formula C18H17F3N2O5 and a molecular weight of 398.34 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] (2S)-2-(furan-2-carbonylamino)-3-methylbutanoate.
| Compound Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] (2S)-2-(furan-2-carbonylamino)-3-methylbutanoate |
|---|---|
| PubChem CID | 2448157 |
| Molecular Formula | C18H17F3N2O5 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] (2S)-2-(furan-2-carbonylamino)-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)c1ccco1)C(=O)OCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H17F3N2O5/c1-9(2)16(23-17(25)12-4-3-7-27-12)18(26)28-8-13(24)22-11-6-5-10(19)14(20)15(11)21/h3-7,9,16H,8H2,1-2H3,(H,22,24)(H,23,25)/t16-/m0/s1 |
| InChIKey | JYTYKJDLBAPSKF-INIZCTEOSA-N |
| XLogP | 2.63 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|