C16H29N3O — CID 70475064
1-ethyl-3-phenylurea;2-methyl-N-propylpropan-2-amine (PubChem CID 70475064) has the molecular formula C16H29N3O and a molecular weight of 279.43 g/mol. Its IUPAC name is 1-ethyl-3-phenylurea;2-methyl-N-propylpropan-2-amine.
| Compound Name | 1-ethyl-3-phenylurea;2-methyl-N-propylpropan-2-amine |
|---|---|
| PubChem CID | 70475064 |
| Molecular Formula | C16H29N3O |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.23 |
| IUPAC Name | 1-ethyl-3-phenylurea;2-methyl-N-propylpropan-2-amine |
| SMILES | CCCNC(C)(C)C.CCNC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C9H12N2O.C7H17N/c1-2-10-9(12)11-8-6-4-3-5-7-8;1-5-6-8-7(2,3)4/h3-7H,2H2,1H3,(H2,10,11,12);8H,5-6H2,1-4H3 |
| InChIKey | DXUPSEULWZDQRH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |