C11H15N5O2 — CID 64548284
3,5-dimethyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-1,2-oxazole-4-carboxamide (PubChem CID 64548284) has the molecular formula C11H15N5O2 and a molecular weight of 249.27 g/mol. Its IUPAC name is 3,5-dimethyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-1,2-oxazole-4-carboxamide.
| Compound Name | 3,5-dimethyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 64548284 |
| Molecular Formula | C11H15N5O2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 3,5-dimethyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-1,2-oxazole-4-carboxamide |
| SMILES | Cc1noc(C)c1C(=O)NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C11H15N5O2/c1-7-10(8(2)18-16-7)11(17)12-5-3-4-9-13-6-14-15-9/h6H,3-5H2,1-2H3,(H,12,17)(H,13,14,15) |
| InChIKey | IQJCWHFULAELJT-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|