C25H19F3N2O4 — CID 57120566
2-cyano-3-oxo-3-[4-(2-phenoxyethoxy)phenyl]-N-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 57120566) has the molecular formula C25H19F3N2O4 and a molecular weight of 468.43 g/mol. Its IUPAC name is 2-cyano-3-oxo-3-[4-(2-phenoxyethoxy)phenyl]-N-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-cyano-3-oxo-3-[4-(2-phenoxyethoxy)phenyl]-N-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 57120566 |
| Molecular Formula | C25H19F3N2O4 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 2-cyano-3-oxo-3-[4-(2-phenoxyethoxy)phenyl]-N-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | N#CC(C(=O)Nc1ccc(C(F)(F)F)cc1)C(=O)c1ccc(OCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C25H19F3N2O4/c26-25(27,28)18-8-10-19(11-9-18)30-24(32)22(16-29)23(31)17-6-12-21(13-7-17)34-15-14-33-20-4-2-1-3-5-20/h1-13,22H,14-15H2,(H,30,32) |
| InChIKey | ILDMVGYIMKKCGC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|