C24H22F3N3O3 — CID 166375707
2-[(Z)-[amino-(4-phenylmethoxyphenyl)methylidene]amino]oxy-N-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 166375707) has the molecular formula C24H22F3N3O3 and a molecular weight of 457.45 g/mol. Its IUPAC name is 2-[(Z)-[amino-(4-phenylmethoxyphenyl)methylidene]amino]oxy-N-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-[(Z)-[amino-(4-phenylmethoxyphenyl)methylidene]amino]oxy-N-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 166375707 |
| Molecular Formula | C24H22F3N3O3 |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 2-[(Z)-[amino-(4-phenylmethoxyphenyl)methylidene]amino]oxy-N-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(O/N=C(\N)c1ccc(OCc2ccccc2)cc1)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H22F3N3O3/c1-16(23(31)29-20-11-9-19(10-12-20)24(25,26)27)33-30-22(28)18-7-13-21(14-8-18)32-15-17-5-3-2-4-6-17/h2-14,16H,15H2,1H3,(H2,28,30)(H,29,31) |
| InChIKey | KHIHWKKCBJZFIG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|