C26H29N3O3 — CID 72691935
2-[[amino-(4-phenylmethoxyphenyl)methylidene]amino]oxy-N-(2,4,6-trimethylphenyl)propanamide (PubChem CID 72691935) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is 2-[[amino-(4-phenylmethoxyphenyl)methylidene]amino]oxy-N-(2,4,6-trimethylphenyl)propanamide.
| Compound Name | 2-[[amino-(4-phenylmethoxyphenyl)methylidene]amino]oxy-N-(2,4,6-trimethylphenyl)propanamide |
|---|---|
| PubChem CID | 72691935 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 2-[[amino-(4-phenylmethoxyphenyl)methylidene]amino]oxy-N-(2,4,6-trimethylphenyl)propanamide |
| SMILES | Cc1cc(C)c(NC(=O)C(C)ON=C(N)c2ccc(OCc3ccccc3)cc2)c(C)c1 |
| InChI | InChI=1S/C26H29N3O3/c1-17-14-18(2)24(19(3)15-17)28-26(30)20(4)32-29-25(27)22-10-12-23(13-11-22)31-16-21-8-6-5-7-9-21/h5-15,20H,16H2,1-4H3,(H2,27,29)(H,28,30) |
| InChIKey | DBOHYMHDQRKUKF-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|