C21H25F2N3O4 — CID 55515599
2-[(Z)-[amino-[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]amino]oxy-N-(2,4,6-trimethylphenyl)propanamide (PubChem CID 55515599) has the molecular formula C21H25F2N3O4 and a molecular weight of 421.44 g/mol. Its IUPAC name is 2-[(Z)-[amino-[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]amino]oxy-N-(2,4,6-trimethylphenyl)propanamide.
| Compound Name | 2-[(Z)-[amino-[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]amino]oxy-N-(2,4,6-trimethylphenyl)propanamide |
|---|---|
| PubChem CID | 55515599 |
| Molecular Formula | C21H25F2N3O4 |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-[(Z)-[amino-[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]amino]oxy-N-(2,4,6-trimethylphenyl)propanamide |
| SMILES | COc1cc(/C(N)=N/OC(C)C(=O)Nc2c(C)cc(C)cc2C)ccc1OC(F)F |
| InChI | InChI=1S/C21H25F2N3O4/c1-11-8-12(2)18(13(3)9-11)25-20(27)14(4)30-26-19(24)15-6-7-16(29-21(22)23)17(10-15)28-5/h6-10,14,21H,1-5H3,(H2,24,26)(H,25,27) |
| InChIKey | FMMUTEQFJYJWJA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|