C19H20ClF2N3O4 — CID 55435746
2-[(Z)-[amino-[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]amino]oxy-N-[(2-chlorophenyl)methyl]propanamide (PubChem CID 55435746) has the molecular formula C19H20ClF2N3O4 and a molecular weight of 427.84 g/mol. Its IUPAC name is 2-[(Z)-[amino-[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]amino]oxy-N-[(2-chlorophenyl)methyl]propanamide.
| Compound Name | 2-[(Z)-[amino-[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]amino]oxy-N-[(2-chlorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 55435746 |
| Molecular Formula | C19H20ClF2N3O4 |
| Molecular Weight | 427.84 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 2-[(Z)-[amino-[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]amino]oxy-N-[(2-chlorophenyl)methyl]propanamide |
| SMILES | COc1cc(/C(N)=N/OC(C)C(=O)NCc2ccccc2Cl)ccc1OC(F)F |
| InChI | InChI=1S/C19H20ClF2N3O4/c1-11(18(26)24-10-13-5-3-4-6-14(13)20)29-25-17(23)12-7-8-15(28-19(21)22)16(9-12)27-2/h3-9,11,19H,10H2,1-2H3,(H2,23,25)(H,24,26) |
| InChIKey | SUJQIAQDSUHZDL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.84 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|