C16H15F3N2O3 — CID 95568429
4-(difluoromethoxy)-N'-[(2-fluorophenyl)methoxy]-3-methoxybenzenecarboximidamide (PubChem CID 95568429) has the molecular formula C16H15F3N2O3 and a molecular weight of 340.30 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N'-[(2-fluorophenyl)methoxy]-3-methoxybenzenecarboximidamide.
| Compound Name | 4-(difluoromethoxy)-N'-[(2-fluorophenyl)methoxy]-3-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 95568429 |
| Molecular Formula | C16H15F3N2O3 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 4-(difluoromethoxy)-N'-[(2-fluorophenyl)methoxy]-3-methoxybenzenecarboximidamide |
| SMILES | COc1cc(/C(N)=N\OCc2ccccc2F)ccc1OC(F)F |
| InChI | InChI=1S/C16H15F3N2O3/c1-22-14-8-10(6-7-13(14)24-16(18)19)15(20)21-23-9-11-4-2-3-5-12(11)17/h2-8,16H,9H2,1H3,(H2,20,21) |
| InChIKey | BXMOIVVUBDPLPC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|