C20H21F2N3O5 — CID 55365572
N-(3-acetylphenyl)-2-[(Z)-[amino-[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]amino]oxypropanamide (PubChem CID 55365572) has the molecular formula C20H21F2N3O5 and a molecular weight of 421.40 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-[(Z)-[amino-[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]amino]oxypropanamide.
| Compound Name | N-(3-acetylphenyl)-2-[(Z)-[amino-[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]amino]oxypropanamide |
|---|---|
| PubChem CID | 55365572 |
| Molecular Formula | C20H21F2N3O5 |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | N-(3-acetylphenyl)-2-[(Z)-[amino-[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]amino]oxypropanamide |
| SMILES | COc1cc(/C(N)=N/OC(C)C(=O)Nc2cccc(C(C)=O)c2)ccc1OC(F)F |
| InChI | InChI=1S/C20H21F2N3O5/c1-11(26)13-5-4-6-15(9-13)24-19(27)12(2)30-25-18(23)14-7-8-16(29-20(21)22)17(10-14)28-3/h4-10,12,20H,1-3H3,(H2,23,25)(H,24,27) |
| InChIKey | ORRPXPVCSLRIQZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|