C19H16F3N3O3 — CID 60561738
4-(difluoromethoxy)-N'-[(5-fluoroquinolin-8-yl)methoxy]-3-methoxybenzenecarboximidamide (PubChem CID 60561738) has the molecular formula C19H16F3N3O3 and a molecular weight of 391.35 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N'-[(5-fluoroquinolin-8-yl)methoxy]-3-methoxybenzenecarboximidamide.
| Compound Name | 4-(difluoromethoxy)-N'-[(5-fluoroquinolin-8-yl)methoxy]-3-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 60561738 |
| Molecular Formula | C19H16F3N3O3 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 4-(difluoromethoxy)-N'-[(5-fluoroquinolin-8-yl)methoxy]-3-methoxybenzenecarboximidamide |
| SMILES | COc1cc(/C(N)=N/OCc2ccc(F)c3cccnc23)ccc1OC(F)F |
| InChI | InChI=1S/C19H16F3N3O3/c1-26-16-9-11(5-7-15(16)28-19(21)22)18(23)25-27-10-12-4-6-14(20)13-3-2-8-24-17(12)13/h2-9,19H,10H2,1H3,(H2,23,25) |
| InChIKey | SHBHMASLTDJREJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|