C20H19F3N4O4 — CID 71855842
4-(difluoromethoxy)-N'-[1-[3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]ethoxy]-3-methoxybenzenecarboximidamide (PubChem CID 71855842) has the molecular formula C20H19F3N4O4 and a molecular weight of 436.39 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N'-[1-[3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]ethoxy]-3-methoxybenzenecarboximidamide.
| Compound Name | 4-(difluoromethoxy)-N'-[1-[3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]ethoxy]-3-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 71855842 |
| Molecular Formula | C20H19F3N4O4 |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 4-(difluoromethoxy)-N'-[1-[3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]ethoxy]-3-methoxybenzenecarboximidamide |
| SMILES | COc1cc(/C(N)=N/OC(C)c2nc(Cc3ccc(F)cc3)no2)ccc1OC(F)F |
| InChI | InChI=1S/C20H19F3N4O4/c1-11(19-25-17(26-31-19)9-12-3-6-14(21)7-4-12)30-27-18(24)13-5-8-15(29-20(22)23)16(10-13)28-2/h3-8,10-11,20H,9H2,1-2H3,(H2,24,27) |
| InChIKey | PVBJODPKGGHCRF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 104.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|