C22H25F2N3O6 — CID 55501214
4-(difluoromethoxy)-N'-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethoxy]-3-methoxybenzenecarboximidamide (PubChem CID 55501214) has the molecular formula C22H25F2N3O6 and a molecular weight of 465.45 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N'-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethoxy]-3-methoxybenzenecarboximidamide.
| Compound Name | 4-(difluoromethoxy)-N'-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethoxy]-3-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 55501214 |
| Molecular Formula | C22H25F2N3O6 |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 4-(difluoromethoxy)-N'-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethoxy]-3-methoxybenzenecarboximidamide |
| SMILES | COc1cc2c(cc1OC)CN(C(=O)CON=C(N)c1ccc(OC(F)F)c(OC)c1)CC2 |
| InChI | InChI=1S/C22H25F2N3O6/c1-29-17-9-14(4-5-16(17)33-22(23)24)21(25)26-32-12-20(28)27-7-6-13-8-18(30-2)19(31-3)10-15(13)11-27/h4-5,8-10,22H,6-7,11-12H2,1-3H3,(H2,25,26) |
| InChIKey | UIPRPEUHIFXHRA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 104.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|