C20H18N2O2 — CID 108528326
N'-(2-ethylphenyl)-N-naphthalen-2-yloxamide (PubChem CID 108528326) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is N'-(2-ethylphenyl)-N-naphthalen-2-yloxamide.
| Compound Name | N'-(2-ethylphenyl)-N-naphthalen-2-yloxamide |
|---|---|
| PubChem CID | 108528326 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N'-(2-ethylphenyl)-N-naphthalen-2-yloxamide |
| SMILES | CCc1ccccc1NC(=O)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H18N2O2/c1-2-14-7-5-6-10-18(14)22-20(24)19(23)21-17-12-11-15-8-3-4-9-16(15)13-17/h3-13H,2H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | ILEXCELDFNSANH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|