C14H11F3N4O — CID 109272138
N-prop-2-enyl-5-(2,3,4-trifluoroanilino)pyrazine-2-carboxamide (PubChem CID 109272138) has the molecular formula C14H11F3N4O and a molecular weight of 308.26 g/mol. Its IUPAC name is N-prop-2-enyl-5-(2,3,4-trifluoroanilino)pyrazine-2-carboxamide.
| Compound Name | N-prop-2-enyl-5-(2,3,4-trifluoroanilino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109272138 |
| Molecular Formula | C14H11F3N4O |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | N-prop-2-enyl-5-(2,3,4-trifluoroanilino)pyrazine-2-carboxamide |
| SMILES | C=CCNC(=O)c1cnc(Nc2ccc(F)c(F)c2F)cn1 |
| InChI | InChI=1S/C14H11F3N4O/c1-2-5-18-14(22)10-6-20-11(7-19-10)21-9-4-3-8(15)12(16)13(9)17/h2-4,6-7H,1,5H2,(H,18,22)(H,20,21) |
| InChIKey | DGOMJABRBXNVHN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|