C13H18Cl2N2O — CID 79805999
2-amino-N-[(2,3-dichlorophenyl)methyl]-N,2-dimethylbutanamide (PubChem CID 79805999) has the molecular formula C13H18Cl2N2O and a molecular weight of 289.21 g/mol. Its IUPAC name is 2-amino-N-[(2,3-dichlorophenyl)methyl]-N,2-dimethylbutanamide.
| Compound Name | 2-amino-N-[(2,3-dichlorophenyl)methyl]-N,2-dimethylbutanamide |
|---|---|
| PubChem CID | 79805999 |
| Molecular Formula | C13H18Cl2N2O |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2-amino-N-[(2,3-dichlorophenyl)methyl]-N,2-dimethylbutanamide |
| SMILES | CCC(C)(N)C(=O)N(C)Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H18Cl2N2O/c1-4-13(2,16)12(18)17(3)8-9-6-5-7-10(14)11(9)15/h5-7H,4,8,16H2,1-3H3 |
| InChIKey | ZPCPUWIOHLBCNC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |