C17H17F2N3O2 — CID 86988362
N-[4-fluoro-3-[[(3-fluorophenyl)methyl-methylcarbamoyl]amino]phenyl]acetamide (PubChem CID 86988362) has the molecular formula C17H17F2N3O2 and a molecular weight of 333.34 g/mol. Its IUPAC name is N-[4-fluoro-3-[[(3-fluorophenyl)methyl-methylcarbamoyl]amino]phenyl]acetamide.
| Compound Name | N-[4-fluoro-3-[[(3-fluorophenyl)methyl-methylcarbamoyl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 86988362 |
| Molecular Formula | C17H17F2N3O2 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | N-[4-fluoro-3-[[(3-fluorophenyl)methyl-methylcarbamoyl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(F)c(NC(=O)N(C)Cc2cccc(F)c2)c1 |
| InChI | InChI=1S/C17H17F2N3O2/c1-11(23)20-14-6-7-15(19)16(9-14)21-17(24)22(2)10-12-4-3-5-13(18)8-12/h3-9H,10H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | OGACZHJOOVWXDH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |