C18H18FN3O3 — CID 87039893
N-(5-acetamido-2-fluorophenyl)-N'-benzyl-N'-methyloxamide (PubChem CID 87039893) has the molecular formula C18H18FN3O3 and a molecular weight of 343.36 g/mol. Its IUPAC name is N-(5-acetamido-2-fluorophenyl)-N'-benzyl-N'-methyloxamide.
| Compound Name | N-(5-acetamido-2-fluorophenyl)-N'-benzyl-N'-methyloxamide |
|---|---|
| PubChem CID | 87039893 |
| Molecular Formula | C18H18FN3O3 |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | N-(5-acetamido-2-fluorophenyl)-N'-benzyl-N'-methyloxamide |
| SMILES | CC(=O)Nc1ccc(F)c(NC(=O)C(=O)N(C)Cc2ccccc2)c1 |
| InChI | InChI=1S/C18H18FN3O3/c1-12(23)20-14-8-9-15(19)16(10-14)21-17(24)18(25)22(2)11-13-6-4-3-5-7-13/h3-10H,11H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | IQGKGVRGMXMUQK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|