C17H25Cl2N3O2S — CID 21063803
2-amino-N-[1-[2-(2,4-dichlorophenyl)ethylamino]-1-oxo-3-sulfanylpropan-2-yl]-4-methylpentanamide (PubChem CID 21063803) has the molecular formula C17H25Cl2N3O2S and a molecular weight of 406.38 g/mol. Its IUPAC name is 2-amino-N-[1-[2-(2,4-dichlorophenyl)ethylamino]-1-oxo-3-sulfanylpropan-2-yl]-4-methylpentanamide.
| Compound Name | 2-amino-N-[1-[2-(2,4-dichlorophenyl)ethylamino]-1-oxo-3-sulfanylpropan-2-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 21063803 |
| Molecular Formula | C17H25Cl2N3O2S |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 2-amino-N-[1-[2-(2,4-dichlorophenyl)ethylamino]-1-oxo-3-sulfanylpropan-2-yl]-4-methylpentanamide |
| SMILES | CC(C)CC(N)C(=O)NC(CS)C(=O)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H25Cl2N3O2S/c1-10(2)7-14(20)16(23)22-15(9-25)17(24)21-6-5-11-3-4-12(18)8-13(11)19/h3-4,8,10,14-15,25H,5-7,9,20H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | NUTLYHDVUUYGNK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|