C18H24N4O3 — CID 108960490
N-(3-cyanophenyl)-2,2-dimethyl-N'-(2-morpholin-4-ylethyl)propanediamide (PubChem CID 108960490) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2,2-dimethyl-N'-(2-morpholin-4-ylethyl)propanediamide.
| Compound Name | N-(3-cyanophenyl)-2,2-dimethyl-N'-(2-morpholin-4-ylethyl)propanediamide |
|---|---|
| PubChem CID | 108960490 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | N-(3-cyanophenyl)-2,2-dimethyl-N'-(2-morpholin-4-ylethyl)propanediamide |
| SMILES | CC(C)(C(=O)NCCN1CCOCC1)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C18H24N4O3/c1-18(2,16(23)20-6-7-22-8-10-25-11-9-22)17(24)21-15-5-3-4-14(12-15)13-19/h3-5,12H,6-11H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | PAEYGNBMDNNJOY-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|