C17H23Cl2N3O3 — CID 108960486
N-(2,3-dichlorophenyl)-2,2-dimethyl-N'-(2-morpholin-4-ylethyl)propanediamide (PubChem CID 108960486) has the molecular formula C17H23Cl2N3O3 and a molecular weight of 388.30 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2,2-dimethyl-N'-(2-morpholin-4-ylethyl)propanediamide.
| Compound Name | N-(2,3-dichlorophenyl)-2,2-dimethyl-N'-(2-morpholin-4-ylethyl)propanediamide |
|---|---|
| PubChem CID | 108960486 |
| Molecular Formula | C17H23Cl2N3O3 |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2,2-dimethyl-N'-(2-morpholin-4-ylethyl)propanediamide |
| SMILES | CC(C)(C(=O)NCCN1CCOCC1)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H23Cl2N3O3/c1-17(2,15(23)20-6-7-22-8-10-25-11-9-22)16(24)21-13-5-3-4-12(18)14(13)19/h3-5H,6-11H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | PRXYSEDJMCUQJJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|