C10H11N2O4P — CID 125478329
[3-(3-cyanoanilino)-3-oxopropyl]phosphonic acid (PubChem CID 125478329) has the molecular formula C10H11N2O4P and a molecular weight of 254.18 g/mol. Its IUPAC name is [3-(3-cyanoanilino)-3-oxopropyl]phosphonic acid.
| Compound Name | [3-(3-cyanoanilino)-3-oxopropyl]phosphonic acid |
|---|---|
| PubChem CID | 125478329 |
| Molecular Formula | C10H11N2O4P |
| Molecular Weight | 254.18 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | [3-(3-cyanoanilino)-3-oxopropyl]phosphonic acid |
| SMILES | N#Cc1cccc(NC(=O)CCP(=O)(O)O)c1 |
| InChI | InChI=1S/C10H11N2O4P/c11-7-8-2-1-3-9(6-8)12-10(13)4-5-17(14,15)16/h1-3,6H,4-5H2,(H,12,13)(H2,14,15,16) |
| InChIKey | HYSJMTTVNWVUIH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.18 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|