C23H24ClN2O2+ — CID 8852725
[(R)-(4-chlorophenyl)-phenylmethyl]-[2-[(2-methoxyphenyl)methylamino]-2-oxoethyl]azanium (PubChem CID 8852725) has the molecular formula C23H24ClN2O2+ and a molecular weight of 395.91 g/mol. Its IUPAC name is [(R)-(4-chlorophenyl)-phenylmethyl]-[2-[(2-methoxyphenyl)methylamino]-2-oxoethyl]azanium.
| Compound Name | [(R)-(4-chlorophenyl)-phenylmethyl]-[2-[(2-methoxyphenyl)methylamino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8852725 |
| Molecular Formula | C23H24ClN2O2+ |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | [(R)-(4-chlorophenyl)-phenylmethyl]-[2-[(2-methoxyphenyl)methylamino]-2-oxoethyl]azanium |
| SMILES | COc1ccccc1CNC(=O)C[NH2+][C@H](c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H23ClN2O2/c1-28-21-10-6-5-9-19(21)15-25-22(27)16-26-23(17-7-3-2-4-8-17)18-11-13-20(24)14-12-18/h2-14,23,26H,15-16H2,1H3,(H,25,27)/p+1/t23-/m1/s1 |
| InChIKey | MRPFZTIOVOQIEN-HSZRJFAPSA-O |
| XLogP | 3.32 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |