C24H26N3O2+ — CID 9445736
benzhydryl-[2-[(2,3-dimethylphenyl)carbamoylamino]-2-oxoethyl]azanium (PubChem CID 9445736) has the molecular formula C24H26N3O2+ and a molecular weight of 388.49 g/mol. Its IUPAC name is benzhydryl-[2-[(2,3-dimethylphenyl)carbamoylamino]-2-oxoethyl]azanium.
| Compound Name | benzhydryl-[2-[(2,3-dimethylphenyl)carbamoylamino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9445736 |
| Molecular Formula | C24H26N3O2+ |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | benzhydryl-[2-[(2,3-dimethylphenyl)carbamoylamino]-2-oxoethyl]azanium |
| SMILES | Cc1cccc(NC(=O)NC(=O)C[NH2+]C(c2ccccc2)c2ccccc2)c1C |
| InChI | InChI=1S/C24H25N3O2/c1-17-10-9-15-21(18(17)2)26-24(29)27-22(28)16-25-23(19-11-5-3-6-12-19)20-13-7-4-8-14-20/h3-15,23,25H,16H2,1-2H3,(H2,26,27,28,29)/p+1 |
| InChIKey | BECQKNDSQRUSLX-UHFFFAOYSA-O |
| XLogP | 3.30 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |