C24H24N3O+ — CID 9392111
[(2R)-1-(4-cyanoanilino)-1-oxopropan-2-yl]-[(S)-(4-methylphenyl)-phenylmethyl]azanium (PubChem CID 9392111) has the molecular formula C24H24N3O+ and a molecular weight of 370.48 g/mol. Its IUPAC name is [(2R)-1-(4-cyanoanilino)-1-oxopropan-2-yl]-[(S)-(4-methylphenyl)-phenylmethyl]azanium.
| Compound Name | [(2R)-1-(4-cyanoanilino)-1-oxopropan-2-yl]-[(S)-(4-methylphenyl)-phenylmethyl]azanium |
|---|---|
| PubChem CID | 9392111 |
| Molecular Formula | C24H24N3O+ |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | [(2R)-1-(4-cyanoanilino)-1-oxopropan-2-yl]-[(S)-(4-methylphenyl)-phenylmethyl]azanium |
| SMILES | Cc1ccc([C@@H]([NH2+][C@H](C)C(=O)Nc2ccc(C#N)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H23N3O/c1-17-8-12-21(13-9-17)23(20-6-4-3-5-7-20)26-18(2)24(28)27-22-14-10-19(16-25)11-15-22/h3-15,18,23,26H,1-2H3,(H,27,28)/p+1/t18-,23+/m1/s1 |
| InChIKey | NOTFBZJJWTZYQD-JPYJTQIMSA-O |
| XLogP | 3.55 |
| TPSA | 69.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |