C23H23F2N2O2+ — CID 8720416
[(2R)-1-anilino-1-oxopropan-2-yl]-[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]azanium (PubChem CID 8720416) has the molecular formula C23H23F2N2O2+ and a molecular weight of 397.45 g/mol. Its IUPAC name is [(2R)-1-anilino-1-oxopropan-2-yl]-[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]azanium.
| Compound Name | [(2R)-1-anilino-1-oxopropan-2-yl]-[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]azanium |
|---|---|
| PubChem CID | 8720416 |
| Molecular Formula | C23H23F2N2O2+ |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | [(2R)-1-anilino-1-oxopropan-2-yl]-[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]azanium |
| SMILES | C[C@@H]([NH2+][C@H](c1ccccc1)c1ccc(OC(F)F)cc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C23H22F2N2O2/c1-16(22(28)27-19-10-6-3-7-11-19)26-21(17-8-4-2-5-9-17)18-12-14-20(15-13-18)29-23(24)25/h2-16,21,23,26H,1H3,(H,27,28)/p+1/t16-,21-/m1/s1 |
| InChIKey | RVYFSAFOUWDKJJ-IIBYNOLFSA-O |
| XLogP | 3.97 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |