C23H26N3O3S+ — CID 9391984
[(S)-(4-methylphenyl)-phenylmethyl]-[(2R)-1-oxo-1-(4-sulfamoylanilino)propan-2-yl]azanium (PubChem CID 9391984) has the molecular formula C23H26N3O3S+ and a molecular weight of 424.55 g/mol. Its IUPAC name is [(S)-(4-methylphenyl)-phenylmethyl]-[(2R)-1-oxo-1-(4-sulfamoylanilino)propan-2-yl]azanium.
| Compound Name | [(S)-(4-methylphenyl)-phenylmethyl]-[(2R)-1-oxo-1-(4-sulfamoylanilino)propan-2-yl]azanium |
|---|---|
| PubChem CID | 9391984 |
| Molecular Formula | C23H26N3O3S+ |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | [(S)-(4-methylphenyl)-phenylmethyl]-[(2R)-1-oxo-1-(4-sulfamoylanilino)propan-2-yl]azanium |
| SMILES | Cc1ccc([C@@H]([NH2+][C@H](C)C(=O)Nc2ccc(S(N)(=O)=O)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H25N3O3S/c1-16-8-10-19(11-9-16)22(18-6-4-3-5-7-18)25-17(2)23(27)26-20-12-14-21(15-13-20)30(24,28)29/h3-15,17,22,25H,1-2H3,(H,26,27)(H2,24,28,29)/p+1/t17-,22+/m1/s1 |
| InChIKey | MHUDYZOKXBIYFD-VGSWGCGISA-O |
| XLogP | 2.32 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |