C23H32N3O3S+ — CID 9131656
[(1S)-2-methyl-1-phenylpropyl]-[2-oxo-2-(4-piperidin-1-ylsulfonylanilino)ethyl]azanium (PubChem CID 9131656) has the molecular formula C23H32N3O3S+ and a molecular weight of 430.59 g/mol. Its IUPAC name is [(1S)-2-methyl-1-phenylpropyl]-[2-oxo-2-(4-piperidin-1-ylsulfonylanilino)ethyl]azanium.
| Compound Name | [(1S)-2-methyl-1-phenylpropyl]-[2-oxo-2-(4-piperidin-1-ylsulfonylanilino)ethyl]azanium |
|---|---|
| PubChem CID | 9131656 |
| Molecular Formula | C23H32N3O3S+ |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | [(1S)-2-methyl-1-phenylpropyl]-[2-oxo-2-(4-piperidin-1-ylsulfonylanilino)ethyl]azanium |
| SMILES | CC(C)[C@H]([NH2+]CC(=O)Nc1ccc(S(=O)(=O)N2CCCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H31N3O3S/c1-18(2)23(19-9-5-3-6-10-19)24-17-22(27)25-20-11-13-21(14-12-20)30(28,29)26-15-7-4-8-16-26/h3,5-6,9-14,18,23-24H,4,7-8,15-17H2,1-2H3,(H,25,27)/p+1/t23-/m0/s1 |
| InChIKey | FAMZAPCVOPPHMP-QHCPKHFHSA-O |
| XLogP | 2.76 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |