C15H16ClNO2 — CID 171863014
1-(3-anilinophenyl)-3-chloropropane-1,2-diol (PubChem CID 171863014) has the molecular formula C15H16ClNO2 and a molecular weight of 277.75 g/mol. Its IUPAC name is 1-(3-anilinophenyl)-3-chloropropane-1,2-diol.
| Compound Name | 1-(3-anilinophenyl)-3-chloropropane-1,2-diol |
|---|---|
| PubChem CID | 171863014 |
| Molecular Formula | C15H16ClNO2 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 1-(3-anilinophenyl)-3-chloropropane-1,2-diol |
| SMILES | OC(CCl)C(O)c1cccc(Nc2ccccc2)c1 |
| InChI | InChI=1S/C15H16ClNO2/c16-10-14(18)15(19)11-5-4-8-13(9-11)17-12-6-2-1-3-7-12/h1-9,14-15,17-19H,10H2 |
| InChIKey | SOBUAJHGYNXKJO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|