C12H18ClNO2 — CID 171862449
3-chloro-1-[3-(ethylaminomethyl)phenyl]propane-1,2-diol (PubChem CID 171862449) has the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. Its IUPAC name is 3-chloro-1-[3-(ethylaminomethyl)phenyl]propane-1,2-diol.
| Compound Name | 3-chloro-1-[3-(ethylaminomethyl)phenyl]propane-1,2-diol |
|---|---|
| PubChem CID | 171862449 |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 3-chloro-1-[3-(ethylaminomethyl)phenyl]propane-1,2-diol |
| SMILES | CCNCc1cccc(C(O)C(O)CCl)c1 |
| InChI | InChI=1S/C12H18ClNO2/c1-2-14-8-9-4-3-5-10(6-9)12(16)11(15)7-13/h3-6,11-12,14-16H,2,7-8H2,1H3 |
| InChIKey | GJNMIINGVDQBIT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|