C17H23NO4 — CID 171884393
tert-butyl N-[4-(4-ethynylphenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171884393) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is tert-butyl N-[4-(4-ethynylphenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | tert-butyl N-[4-(4-ethynylphenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171884393 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | tert-butyl N-[4-(4-ethynylphenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | C#Cc1ccc(C(O)C(O)CCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H23NO4/c1-5-12-6-8-13(9-7-12)15(20)14(19)10-11-18-16(21)22-17(2,3)4/h1,6-9,14-15,19-20H,10-11H2,2-4H3,(H,18,21) |
| InChIKey | JDFVAXGXGFCNEH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|