C17H22FNO4 — CID 90787456
tert-butyl N-[(2S)-2-(3-fluorophenyl)-2-(5-oxooxolan-2-yl)ethyl]carbamate (PubChem CID 90787456) has the molecular formula C17H22FNO4 and a molecular weight of 323.36 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-(3-fluorophenyl)-2-(5-oxooxolan-2-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-(3-fluorophenyl)-2-(5-oxooxolan-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 90787456 |
| Molecular Formula | C17H22FNO4 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | tert-butyl N-[(2S)-2-(3-fluorophenyl)-2-(5-oxooxolan-2-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@H](c1cccc(F)c1)C1CCC(=O)O1 |
| InChI | InChI=1S/C17H22FNO4/c1-17(2,3)23-16(21)19-10-13(14-7-8-15(20)22-14)11-5-4-6-12(18)9-11/h4-6,9,13-14H,7-8,10H2,1-3H3,(H,19,21)/t13-,14?/m1/s1 |
| InChIKey | PHJOCOLNESQCIM-KWCCSABGSA-N |
| XLogP | 3.14 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |