C24H45N3O7 — CID 147401008
tert-butyl (6S)-8-[2-methyl-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]hydrazinyl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxooctanoate (PubChem CID 147401008) has the molecular formula C24H45N3O7 and a molecular weight of 487.64 g/mol. Its IUPAC name is tert-butyl (6S)-8-[2-methyl-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]hydrazinyl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxooctanoate.
| Compound Name | tert-butyl (6S)-8-[2-methyl-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]hydrazinyl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxooctanoate |
|---|---|
| PubChem CID | 147401008 |
| Molecular Formula | C24H45N3O7 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.33 |
| IUPAC Name | tert-butyl (6S)-8-[2-methyl-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]hydrazinyl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxooctanoate |
| SMILES | CN(CC(=O)OC(C)(C)C)NC(=O)C[C@H](CCCCC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H45N3O7/c1-22(2,3)32-19(29)14-12-11-13-17(25-21(31)34-24(7,8)9)15-18(28)26-27(10)16-20(30)33-23(4,5)6/h17H,11-16H2,1-10H3,(H,25,31)(H,26,28)/t17-/m0/s1 |
| InChIKey | DOTBHDCUEIKZEQ-KRWDZBQOSA-N |
| XLogP | 3.48 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|