C11H17NO5 — CID 101154656
(2R)-6-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-4-ynoic acid (PubChem CID 101154656) has the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. Its IUPAC name is (2R)-6-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-4-ynoic acid.
| Compound Name | (2R)-6-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-4-ynoic acid |
|---|---|
| PubChem CID | 101154656 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | (2R)-6-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-4-ynoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC#CCO)C(=O)O |
| InChI | InChI=1S/C11H17NO5/c1-11(2,3)17-10(16)12-8(9(14)15)6-4-5-7-13/h8,13H,6-7H2,1-3H3,(H,12,16)(H,14,15)/t8-/m1/s1 |
| InChIKey | XUDJHYZIHFUWEY-MRVPVSSYSA-N |
| XLogP | 0.35 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|