C19H34FNO5 — CID 143896158
methyl (2S,4S)-10-fluoro-4-(1-methoxyethenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]decanoate (PubChem CID 143896158) has the molecular formula C19H34FNO5 and a molecular weight of 375.48 g/mol. Its IUPAC name is methyl (2S,4S)-10-fluoro-4-(1-methoxyethenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]decanoate.
| Compound Name | methyl (2S,4S)-10-fluoro-4-(1-methoxyethenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]decanoate |
|---|---|
| PubChem CID | 143896158 |
| Molecular Formula | C19H34FNO5 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | methyl (2S,4S)-10-fluoro-4-(1-methoxyethenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]decanoate |
| SMILES | C=C(OC)[C@@H](CCCCCCF)C[C@H](NC(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C19H34FNO5/c1-14(24-5)15(11-9-7-8-10-12-20)13-16(17(22)25-6)21-18(23)26-19(2,3)4/h15-16H,1,7-13H2,2-6H3,(H,21,23)/t15-,16-/m0/s1 |
| InChIKey | KELNKKYLEMEKCY-HOTGVXAUSA-N |
| XLogP | 4.14 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|